6.3 Practical Measurement, Optimization, and Trigonometric Modeling

Key Takeaways

  • Practical geometric surveying models convert 2D/3D real-world measurements into multi-triangle solving problems using angles of elevation, depression, and bearing.
  • Optimization of triangle area S or perimeter P can be achieved via Trigonometric Substitution (converting to a single-angle function f(\theta)) or Algebraic Inequalities (AM-GM inequality).
  • The domain of single-variable trigonometric models must be strictly bounded by internal angle constraints (0 < A, B, C < \pi and A+B+C=\pi) and side inequality conditions.
  • Equilateral or symmetric configurations (B = C) systematically produce peak extrema for perimeter and area when a single side and its opposite angle are held constant.
Last updated: July 2026

6.3 Practical Measurement, Optimization, and Trigonometric Modeling

Real-world applications and optimization problems (最值与范围问题) represent the highest tier of difficulty in the Gaokao triangle module. These problems test a student's ability to extract geometric models from textual scenarios, set up single-variable trigonometric functions, and apply algebraic inequalities under strict geometric domain constraints.


1. Terminology and Models in Practical Measurement

Directional and Spatial Angle Definitions

  1. Angle of Elevation (仰角): The angle between the line of sight and the horizontal plane when looking upward at a target.
  2. Angle of Depression (俯角): The angle between the line of sight and the horizontal plane when looking downward at a target.
  3. Bearing Angle (方位角): The angle measured clockwise starting from due North ($0^\circ$) to the line of direction, ranging from $0^\circ$ to $360^\circ$.
  4. Direction Angle (方向角): Direction specified relative to cardinal directions, e.g., "North $30^\circ$ East" (北偏东 $30^\circ$), meaning rotated $30^\circ$ toward East from due North.
                  North (0° / 360°)
                        |
                        |   / Target (North 30° East)
                        |  / 
                        | / 30°
         West ----------+---------- East (90°)
                        |
                        |
                  South (180°)

Standard 2D and 3D Surveying Structures

  • Inaccessible Distance Model: To measure distance between target points $A$ and $B$ across a river, select a baseline $CD$ on one bank, measure length $CD = d$, and observe angles $\angle ACD, \angle BCD, \angle ADC, \angle BDC$. Solve $\triangle ACD$ and $\triangle BCD$ to get $AC$ and $BC$, then apply the Cosine Theorem in $\triangle ABC$.
  • Height Measurement Model: To measure peak height $h = TT'$ above horizontal ground, set two observation points $A$ and $B$ aligned with baseline $T'$. Measure distance $AB = d$, elevation angles $\alpha = \angle TAT'$ and $\beta = \angle TBT'$. Apply the Sine Theorem in vertical triangle $\triangle TAB$.

2. Optimization Techniques for Triangle Perimeter and Area

When a side $a$ and its opposite angle $A$ are fixed in $\triangle ABC$, the triangle is partially constrained, causing perimeter $P = a + b + c$ and area $S = \frac{1}{2}bc \sin A$ to vary. Two main analytical methods find their extrema:

Method I: Algebraic Inequality Method (AM-GM Inequality)

Applying the Cosine Theorem to fixed $a$ and $A$: a2=b2+c22bccosAa^2 = b^2 + c^2 - 2bc \cos A Since $b^2 + c^2 \ge 2bc$ by AM-GM: a22bc2bccosA=2bc(1cosA)a^2 \ge 2bc - 2bc \cos A = 2bc (1 - \cos A) Rearranging gives an explicit upper bound for product $bc$: bca22(1cosA)bc \le \frac{a^2}{2(1 - \cos A)} Equality holds if and only if $b = c$. Thus, maximum area $S_{max}$ is: Smax=12bcmaxsinA=a2sinA4(1cosA)=a24tan(A/2)S_{max} = \frac{1}{2} bc_{max} \sin A = \frac{a^2 \sin A}{4(1 - \cos A)} = \frac{a^2}{4 \tan(A/2)}

Method II: Trigonometric Single-Variable Substitution

By the Sine Theorem, $b = 2R \sin B$ and $c = 2R \sin C$, where $2R = \frac{a}{\sin A}$. Express $b + c$ as a function of angle $B$: b+c=2R(sinB+sinC)=2R(sinB+sin(πAB))b + c = 2R (\sin B + \sin C) = 2R \left( \sin B + \sin(\pi - A - B) \right) Using sum-to-product or expanding $\sin(\pi - A - B) = \sin(A + B)$: b+c=2R(sinB+sinAcosB+cosAsinB)=2R((1+cosA)sinB+sinAcosB)b + c = 2R \left( \sin B + \sin A \cos B + \cos A \sin B \right) = 2R \left( (1 + \cos A)\sin B + \sin A \cos B \right) By auxiliary angle transformation $C_0 \sin(B + \phi)$: b+c=4Rsin(B+C2)cos(BC2)=4Rcos(A2)cos(BC2)b + c = 4R \sin\left(\frac{B+C}{2}\right) \cos\left(\frac{B-C}{2}\right) = 4R \cos\left(\frac{A}{2}\right) \cos\left(\frac{B-C}{2}\right) Since $\cos\left(\frac{B-C}{2}\right) \le 1$ with equality when $B = C$, the maximum sum of sides is $4R \cos\left(\frac{A}{2}\right)$.


3. Worked Gaokao Exam Examples

Example 1 (Perimeter Range and Extremum Optimization)

In $\triangle ABC$, angle $A = \frac{\pi}{3}$ ($60^\circ$) and opposite side $a = \sqrt{3}$.

  1. Determine the circumradius $R$.
  2. Find the range of the perimeter $P = a + b + c$ and state its maximum value.

Solution:

Part 1: By the Sine Theorem: 2R=asinA=3sinπ3=332=2    R=12R = \frac{a}{\sin A} = \frac{\sqrt{3}}{\sin\frac{\pi}{3}} = \frac{\sqrt{3}}{\frac{\sqrt{3}}{2}} = 2 \implies R = 1

Part 2: Express $b + c$ in terms of angle $B$: b=2RsinB=2sinBb = 2R \sin B = 2 \sin B c=2RsinC=2sin(πAB)=2sin(2π3B)c = 2R \sin C = 2 \sin\left(\pi - A - B\right) = 2 \sin\left(\frac{2\pi}{3} - B\right) Expand $c$: c=2(sin2π3cosBcos2π3sinB)=2(32cosB(12)sinB)=3cosB+sinBc = 2 \left( \sin\frac{2\pi}{3} \cos B - \cos\frac{2\pi}{3} \sin B \right) = 2 \left( \frac{\sqrt{3}}{2} \cos B - \left(-\frac{1}{2}\right) \sin B \right) = \sqrt{3} \cos B + \sin B Summing $b + c$: b+c=2sinB+sinB+3cosB=3sinB+3cosBb + c = 2 \sin B + \sin B + \sqrt{3} \cos B = 3 \sin B + \sqrt{3} \cos B Apply the auxiliary angle formula $A_0 \sin(B + \phi)$ where $A_0 = \sqrt{3^2 + (\sqrt{3})^2} = \sqrt{12} = 2\sqrt{3}$: b+c=23(32sinB+12cosB)=23sin(B+π6)b + c = 2\sqrt{3} \left( \frac{\sqrt{3}}{2} \sin B + \frac{1}{2} \cos B \right) = 2\sqrt{3} \sin\left(B + \frac{\pi}{6}\right) Determine the domain of $B$: since $A = \frac{\pi}{3}$ and $A + B + C = \pi$, we have $0 < B < \frac{2\pi}{3}$. Adding $\frac{\pi}{6}$ to all terms: π6<B+π6<5π6\frac{\pi}{6} < B + \frac{\pi}{6} < \frac{5\pi}{6} Within this interval, the sine function satisfies $\frac{1}{2} < \sin\left(B + \frac{\pi}{6}\right) \le 1$. Multiplying by $2\sqrt{3}$: 3<b+c23\sqrt{3} < b + c \le 2\sqrt{3} Since $a = \sqrt{3}$, the perimeter $P = a + b + c = \sqrt{3} + (b + c)$ has domain: 23<P332\sqrt{3} < P \le 3\sqrt{3} Thus, the range of perimeter $P$ is $(2\sqrt{3}, 3\sqrt{3}]$, and its maximum value is $3\sqrt{3}$ attained when $B + \frac{\pi}{6} = \frac{\pi}{2} \implies B = \frac{\pi}{3} = C$ (equilateral triangle).


Example 2 (Real-World Engineering Surveying Model)

Surveyors at point $A$ observe a target tower $T$ on top of a mountain. Point $A$ is on horizontal ground. The angle of elevation of point $A$ to the mountain base $B$ is $30^\circ$, and to the top of tower $T$ is $45^\circ$. The surveyors walk $100$ meters along a straight slope of incline $30^\circ$ directly toward base $B$ to reach point $C$. From point $C$, the angle of elevation to tower top $T$ is measured to be $60^\circ$. Find the height of the tower $T$ if $B$ and $T$ are vertically aligned.

Solution:

Let the horizontal plane pass through $A$. Path $AC = 100$ m lies along line $AB$ inclined at $30^\circ$. In vertical triangle $\triangle ATC$:

  1. $\angle TAC = 45^\circ - 30^\circ = 15^\circ$.
  2. $\angle TCA = 180^\circ - (60^\circ - 30^\circ) = 150^\circ$.
  3. $\angle ATC = 180^\circ - 15^\circ - 150^\circ = 15^\circ$. Since $\angle TAC = \angle ATC = 15^\circ$, $\triangle ATC$ is an isosceles triangle with $TC = AC = 100$ meters! Now consider right triangle formed by top $T$, base $B$, and point $C$. Using $\triangle TBC$, height $TB$ is found directly: TB=TCsin60=10032=503 metersTB = TC \cdot \sin 60^\circ = 100 \cdot \frac{\sqrt{3}}{2} = 50\sqrt{3} \text{ meters} The tower/mountain structure height is $50\sqrt{3}$ meters.
Loading diagram...
Strategy Comparison for Triangle Extremum Optimization
Test Your Knowledge

In $\triangle ABC$, angle $A = 60^\circ$ and opposite side $a = 2\sqrt{3}$. What is the maximum possible area of $\triangle ABC$?

A
B
C
D
Test Your Knowledge

A surveyor at point $A$ measures the angle of elevation to a cliff top as $30^\circ$. Walking $100$ meters horizontally toward the cliff base to point $B$, the angle of elevation becomes $45^\circ$. What is the height $h$ of the cliff?

A
B
C
D
Test Your Knowledge

In $\triangle ABC$, given side $a = 2$ and opposite angle $A = 60^\circ$, what is the maximum value of the sum of sides $b + c$?

A
B
C
D